
Catalog Number	AR008PZ2
Chemical Name	2H-1-Benzopyran-2-one,3-acetyl-7-(diethylamino)-
CAS Number	74696-96-1
Molecular Formula	C15H17NO3
Molecular Weight	259.3003800000001
MDL Number	MFCD00068687
SMILES	CCN(c1ccc2c(c1)oc(=O)c(c2)C(=O)C)CC

3-Acetyl-7-(diethylamino)coumarin is a versatile compound commonly used in chemical synthesis as a key building block in the production of various pharmaceuticals, agrochemicals, and fluorescent dyes. Its unique structure allows it to participate in a wide range of reactions, making it an essential component in the creation of complex organic molecules. In particular, 3-Acetyl-7-(diethylamino)coumarin is valued for its ability to serve as a fluorescent probe in biological and biochemical studies, enabling researchers to visualize and track specific molecules and processes within living systems. Additionally, this compound is utilized in the development of advanced materials and specialty chemicals due to its properties and reactivity. Whether employed as a fluorescent marker or as a precursor in the synthesis of novel compounds, 3-Acetyl-7-(diethylamino)coumarin plays a crucial role in advancing the field of chemical science.

2H-1-Benzopyran-2-one,3-acetyl-7-(diethylamino)-

74696-96-1

Product Details