
Catalog Number	AR008R55
Chemical Name	Stannane,dichlorodiheptyl-
CAS Number	74340-12-8
Molecular Formula	C14H30Cl2Sn
Molecular Weight	387.995
MDL Number	MFCD03701741
SMILES	CCCCCCC[Sn](CCCCCCC)(Cl)Cl

A commonly used and versatile reagent in chemical synthesis, Stannane, dichlorodiheptyl-, serves as a valuable tool for a variety of transformations and reactions in the laboratory. This compound, with its unique structure containing two chlorine atoms attached to a heptyl group bound to tin, exhibits strong nucleophilic properties, making it particularly useful in organic synthesis. Stannane, dichlorodiheptyl-, is frequently employed in the synthesis of complex organic molecules by facilitating carbon-carbon bond formation through Stille coupling reactions. Additionally, it can act as a reducing agent and participate in radical reactions, enabling the creation of diverse chemical structures. Its application extends to the preparation of pharmaceutical intermediates, agrochemicals, and materials science, showcasing its significance in modern synthetic chemistry.