
Catalog Number	AR003PE7
Chemical Name	Carbenoxolone disodium salt
CAS Number	7421-40-1
Molecular Formula	C34H48Na2O7
Molecular Weight	614.7203
MDL Number	MFCD03840711
SMILES	O=C(OC1CCC2(C(C1(C)C)CCC1(C2C(=O)C=C2C1(C)CCC1(C2CC(C)(CC1)C(=O)[O-])C)C)C)CCC(=O)[O-].[Na+].[Na+]

Carbenoxolone Disodium is a potent compound widely utilized in chemical synthesis for its unique properties and reactivity. This versatile substance has found application as a powerful inhibitor of 11β-Hydroxysteroid dehydrogenase, an enzyme involved in regulating intracellular glucocorticoid levels. Additionally, Carbenoxolone Disodium is known for its ability to enhance the production of nitric oxide and cyclooxygenase-2 (COX-2) expression, making it a valuable tool in the study of inflammatory pathways and related processes.
The compound's structural characteristics provide researchers with a valuable building block for the development of novel medications and therapeutic agents. Its effectiveness in modulating biological processes and its potential as a treatment for various conditions make Carbenoxolone Disodium a key player in the field of chemical synthesis and pharmacology.