
Catalog Number	AR008QDA
Chemical Name	2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribonic-1,4-lactone
CAS Number	7392-74-7
Molecular Formula	C27H22O8
Molecular Weight	474.4588
MDL Number	MFCD07369678
SMILES	O=C(c1ccccc1)O[C@@H]1[C@@H](COC(=O)c2ccccc2)OC(=O)[C@]1(C)OC(=O)c1ccccc1

2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribonic acid-1,4-lactone is a powerful intermediate compound commonly used in chemical synthesis. Its unique structure and reactivity make it a valuable tool for the construction of complex organic molecules.This compound is particularly useful in organic chemistry for the synthesis of various natural products, pharmaceuticals, and functional materials. Its multiple reactive sites allow for selective functionalization, enabling the introduction of specific substituents or functional groups at precise positions within the molecule.In addition, 2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribonic acid-1,4-lactone serves as a versatile building block in the preparation of sugar derivatives and stereochemically complex compounds. Its ability to undergo diverse chemical transformations, such as reduction, oxidation, and coupling reactions, further expands its synthetic utility.Overall, this compound plays a crucial role in the strategic design and assembly of intricate molecular architectures, making it an indispensable tool for chemists engaged in the synthesis of complex molecules for various applications.