
Catalog Number	AR005BA9
Chemical Name	2,4-Dinitrobenzenesulfonamide
CAS Number	73901-01-6
Molecular Formula	C6H5N3O6S
Molecular Weight	247.1854
MDL Number	MFCD09733471
SMILES	[O-][N+](=O)c1cc(ccc1S(=O)(=O)N)[N+](=O)[O-]

2,4-Dinitrobenzenesulfonamide, also known as DNBS, is a versatile compound widely used in chemical synthesis for its unique properties. In organic chemistry, DNBS is commonly employed as a derivatization agent for the identification and quantification of primary and secondary amines. By forming stable derivatives with amino groups, DNBS facilitates the analysis of complex mixtures and enhances the detection sensitivity of these functional groups in various analytical techniques such as chromatography and mass spectrometry.Furthermore, 2,4-Dinitrobenzenesulfonamide is a valuable reagent in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its ability to selectively react with specific functional groups under mild conditions makes it a preferred choice for modifying and protecting amino-containing molecules during organic synthesis. By utilizing DNBS as a building block, chemists can introduce desired properties or functionalities into target compounds with precision and efficiency.Overall, the application of 2,4-Dinitrobenzenesulfonamide in chemical synthesis enables researchers to conduct intricate transformations, optimize reaction pathways, and advance the development of novel materials and compounds across various industries.