
Catalog Number	AR005WW1
Chemical Name	3-Chloro-8-nitroquinoline
CAS Number	73868-16-3
Molecular Formula	C9H5ClN2O2
Molecular Weight	208.6012
MDL Number	MFCD11044981
SMILES	Clc1cnc2c(c1)cccc2[N+](=O)[O-]

3-Chloro-8-nitroquinoline is a versatile compound widely utilized in chemical synthesis due to its unique properties. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its presence as a chlorinated nitroquinoline imparts distinct reactivity, allowing for selective functionalization in diverse synthetic pathways. In organic synthesis, 3-Chloro-8-nitroquinoline acts as a valuable intermediate, facilitating the introduction of different functional groups to generate complex molecular structures. By participating in a range of coupling reactions and transformations, this compound plays a crucial role in the development of novel compounds with potential applications across industries. Additionally, its structural features make it a valuable tool in medicinal chemistry research, enabling the synthesis of innovative drug candidates and bioactive molecules. Overall, the strategic use of 3-Chloro-8-nitroquinoline in chemical synthesis highlights its significance as a key component in advancing the synthesis of valuable compounds with various industrial applications.