
Catalog Number	AR008QLN
Chemical Name	Ranitidine S-oxide
CAS Number	73851-70-4
Molecular Formula	C13H22N4O4S
Molecular Weight	330.4032
MDL Number	MFCD08063699
SMILES	CNC(=C[N+](=O)[O-])NCCS(=O)Cc1ccc(o1)CN(C)C

N-(2-(((5-((Dimethylamino)methyl)furan-2-yl)methyl)sulfinyl)ethyl)-N-methyl-2-nitroethene-1,1-diamine is a versatile compound widely used in chemical synthesis as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. This compound serves as a crucial building block in the creation of complex molecular structures due to its unique reactivity and functional groups. Its sulfone and nitro groups make it an ideal substrate for various transformations, such as reduction, oxidation, and substitution reactions, leading to the synthesis of diverse organic compounds with tailored properties. Additionally, the presence of the furan ring provides an opportunity for further derivatization, enabling the introduction of additional functionalities for specific applications in medicinal chemistry and material science. Overall, the strategic placement of functional groups in N-(2-(((5-((Dimethylamino)methyl)furan-2-yl)methyl)sulfinyl)ethyl)-N-methyl-2-nitroethene-1,1-diamine makes it a valuable component in the construction of complex molecular architectures with enhanced biological activities and physical properties.