
Catalog Number	AR0066I8
Chemical Name	4-Bromo-6-methoxy-1,5-naphthyridin-3-amine
CAS Number	724788-66-3
Molecular Formula	C9H8BrN3O
Molecular Weight	254.0833
MDL Number	MFCD21603858
SMILES	COc1ccc2c(n1)c(Br)c(cn2)N

4-Bromo-6-methoxy-1,5-naphthyridin-3-amine, also known as $name$, serves as a valuable building block in chemical synthesis processes. Its unique structure and reactivity make it an essential intermediate in the production of various organic compounds and pharmaceuticals. This compound is frequently employed in the creation of heterocyclic compounds, which are vital components in medicinal chemistry and drug discovery efforts. Additionally, $name$ can be utilized as a key starting material for the synthesis of biologically active molecules, offering researchers a versatile tool for the construction of complex chemical structures. In the field of organic synthesis, the diverse applications of 4-Bromo-6-methoxy-1,5-naphthyridin-3-amine contribute significantly to the development of innovative materials and compounds for various industrial and scientific purposes.