
Catalog Number	AR0033L6
Chemical Name	2,2,2-Trifluoro-3′-(trifluoromethyl)acetophenone
CAS Number	721-37-9
Molecular Formula	C9H4F6O
Molecular Weight	242.1179
MDL Number	MFCD00061275
SMILES	O=C(C(F)(F)F)c1cccc(c1)C(F)(F)F
NSC Number	55520

2,2,2-Trifluoro-3′-(trifluoromethyl)acetophenone is a versatile compound used in chemical synthesis for various applications. It serves as a key building block in the creation of pharmaceuticals, agrochemicals, and specialty chemicals. This compound is particularly valued for its unique properties, which include high reactivity and stability under a wide range of reaction conditions.In chemical synthesis, 2,2,2-Trifluoro-3′-(trifluoromethyl)acetophenone is commonly employed as a starting material for the preparation of complex organic molecules. Its trifluoromethyl group can serve as a directing group in C–H activation reactions, facilitating the selective functionalization of aromatic compounds. This compound can also undergo various transformations, such as nucleophilic additions, reductions, and cross-coupling reactions, leading to the formation of diverse chemical structures.Additionally, 2,2,2-Trifluoro-3′-(trifluoromethyl)acetophenone is known for its role in the synthesis of fluorinated compounds, which are important in medicinal chemistry and material science. Its trifluoromethyl moiety imparts unique physicochemical properties to the resulting products, enhancing their biological activity or material properties. By incorporating this compound into synthetic routes, chemists can access a wide range of functionalized molecules with improved properties for targeted applications.