
Catalog Number	AR0064JM
Chemical Name	Benzene, 1,1'-(2,2-dichloroethenylidene)bis[4-chloro-
CAS Number	72-55-9
Molecular Formula	C14H8Cl4
Molecular Weight	318.02531999999997
MDL Number	MFCD00000837
SMILES	ClC(=C(c1ccc(cc1)Cl)c1ccc(cc1)Cl)Cl
NSC Number	1153

$name$ is an essential compound in chemical synthesis, specifically in the development of pharmaceuticals and agrochemicals. This compound is utilized as a key building block in the creation of various organic molecules due to its unique chemical properties. The benzene ring provides aromatic stability, while the 1,1'-(2,2-dichloroethenylidene)bis[4-chloro- group serves as a functional group that can undergo various chemical reactions. The presence of chlorine atoms enhances the compound's reactivity, making it a versatile component in the formation of complex molecular structures. When combined with other reagents, $name$ participates in coupling reactions, substitution reactions, and other synthetic pathways crucial for the production of novel compounds with diverse applications in the fields of medicine and agriculture.