
Catalog Number	AR005U8D
Chemical Name	Benzene,1,1'-(2,2,2-trichloroethylidene)bis[4-methoxy-
CAS Number	72-43-5
Molecular Formula	C16H15Cl3O2
Molecular Weight	345.6481
MDL Number	MFCD00000803
SMILES	COc1ccc(cc1)C(C(Cl)(Cl)Cl)c1ccc(cc1)OC
NSC Number	8945

Methoxychlor, a chemical compound with the molecular formula C16H15Cl3O2, plays a crucial role in chemical synthesis as a versatile pesticide precursor. This organochlorine compound is commonly utilized in the manufacturing of various insecticides and acaricides due to its potent pesticidal properties. In chemical synthesis, Methoxychlor serves as a key building block for creating a wide range of agricultural chemicals that effectively target and control pests such as insects and mites. With its ability to disrupt the nervous system of target organisms, Methoxychlor is an essential component in the production of insect control agents used in agriculture, public health, and veterinary applications. Additionally, its stability and efficacy make Methoxychlor a valuable tool in the development of pest management solutions that contribute to sustaining crop productivity and protecting human and animal health.