
Catalog Number	AR003JFO
Chemical Name	3,6-DIMETHYL-2-NITROPHENOL
CAS Number	71608-10-1
Molecular Formula	C8H9NO3
Molecular Weight	167.162
MDL Number	MFCD12198862
SMILES	Cc1ccc(c(c1O)[N+](=O)[O-])C
NSC Number	89793

3,6-Dimethyl-2-nitrophenol is a versatile compound widely utilized in chemical synthesis. Its primary application lies in its role as a key intermediate in the synthesis of various organic compounds. The presence of both nitro and phenol groups in its structure makes it a valuable building block for producing a range of more complex molecules.In chemical synthesis, 3,6-Dimethyl-2-nitrophenol can be used as a precursor in the preparation of dyes, pharmaceuticals, and agrochemicals. Its unique chemical properties allow for selective modifications, enabling the introduction of specific functional groups at precise positions. This level of control is crucial in the design and development of new compounds with tailored properties.Additionally, 3,6-Dimethyl-2-nitrophenol can participate in various organic reactions such as nitration, reduction, and substitution. These reactions enable chemists to access a diverse array of derivatives that can further be utilized in different industrial applications. Overall, the versatility and reactivity of 3,6-Dimethyl-2-nitrophenol make it a valuable tool for organic chemists seeking to create novel molecules with specific characteristics and functionalities.