
Catalog Number	AR003ND8
Chemical Name	5-Chloro-4-methyl-2-nitroaniline
CAS Number	7149-80-6
Molecular Formula	C7H7ClN2O2
Molecular Weight	186.5957
MDL Number	MFCD00034066
SMILES	[O-][N+](=O)c1cc(C)c(cc1N)Cl
NSC Number	72334

5-Chloro-4-methyl-2-nitroaniline, also known as $name$, serves as a vital building block in chemical synthesis processes. This compound finds widespread utility in the pharmaceutical and agrochemical industries due to its unique reactivity profile and versatile functional groups. As a key intermediate, $name$ plays a crucial role in the synthesis of various complex organic molecules and compounds.One significant application of $name$ is in the development of novel pharmaceuticals. Its structural features make it a valuable precursor for synthesizing bioactive molecules and drug candidates. By incorporating 5-Chloro-4-methyl-2-nitroaniline into specific chemical reactions, chemists can introduce structural diversity and fine-tune the properties of potential therapeutic compounds. This compound's ability to undergo various transformations makes it a valuable tool in medicinal chemistry research.Moreover, in the field of agrochemicals, 5-Chloro-4-methyl-2-nitroaniline also plays a crucial role. It can be utilized in the synthesis of pesticides, herbicides, and fungicides with tailored properties for crop protection and pest management. By designing molecules based on $name$, chemists can enhance the efficacy and selectivity of agrochemical products while minimizing environmental impact.Overall, the strategic incorporation of 5-Chloro-4-methyl-2-nitroaniline in chemical synthesis allows for the creation of diverse and multifunctional compounds with applications across various industries. Its importance as a versatile intermediate highlights its significance in advancing the fields of pharmaceuticals, agrochemicals, and organic chemistry.