
Catalog Number	AR00627M
Chemical Name	(3-(Ethylsulfonamido)phenyl)boronic acid
CAS Number	710348-41-7
Molecular Formula	C8H12BNO4S
Molecular Weight	229.0612
MDL Number	MFCD10699609
SMILES	CCS(=O)(=O)Nc1cccc(c1)B(O)O

The (3-(Ethylsulfonamido)phenyl)boronic acid is a versatile compound widely utilized in chemical synthesis as a key building block in the preparation of various organic molecules. Its unique structure containing both a boronic acid group and an ethylsulfonamido group makes it a valuable reagent in the field of organic chemistry.This compound is commonly employed in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. By participating in these coupling reactions, (3-(Ethylsulfonamido)phenyl)boronic acid facilitates the synthesis of complex organic molecules with significant structural diversity.Additionally, this compound can serve as a valuable tool in the pharmaceutical industry for the development of new drug candidates. Its ability to undergo selective transformations under mild reaction conditions makes it a preferred choice for medicinal chemists aiming to design novel therapeutic agents.In summary, the application of (3-(Ethylsulfonamido)phenyl)boronic acid in chemical synthesis extends to the creation of diverse organic compounds and plays a crucial role in advancing both academic research and industrial applications.