
Catalog Number	AR0062W2
Chemical Name	3,3'-DICHLOROBENZOPHENONE
CAS Number	7094-34-0
Molecular Formula	C13H8Cl2O
Molecular Weight	251.1080
MDL Number	MFCD00045192
SMILES	Clc1cccc(c1)C(=O)c1cccc(c1)Cl
NSC Number	407566

Bis(3-chlorophenyl)methanone, also known as 3,3'-dichloroacetophenone, is a versatile chemical compound widely used in chemical synthesis. This compound is valued for its unique reactivity and ability to participate in various organic reactions, making it an essential building block for the synthesis of a wide range of compounds.One significant application of Bis(3-chlorophenyl)methanone in chemical synthesis is its use as a key intermediate in the preparation of pharmaceutical compounds. By serving as a precursor in the synthesis of complex molecules, this compound plays a crucial role in the pharmaceutical industry for the production of drugs with therapeutic properties.Additionally, Bis(3-chlorophenyl)methanone is commonly employed in the synthesis of fine chemicals, agrochemicals, and functional materials. Its reactivity allows for the introduction of the 3-chlorophenyl group into target molecules, enabling the modification of their properties and functions.Furthermore, Bis(3-chlorophenyl)methanone is utilized in organic reactions such as Friedel-Crafts acylation, Grignard reactions, and various coupling reactions. These synthetic pathways enable the incorporation of the 3-chlorophenyl moiety into diverse chemical structures, expanding the scope of potential applications for this compound in chemical synthesis.Overall, Bis(3-chlorophenyl)methanone serves as a valuable tool in chemical synthesis, facilitating the creation of structurally diverse molecules with unique properties and functions. Its versatility and reactivity make it an indispensable compound for the development of novel materials and compounds in various industries.