
Catalog Number	AR0063K4
Chemical Name	Benzenesulfonic acid, 2,4,6-trimethyl-, methyl ester
CAS Number	70920-59-1
Molecular Formula	C10H14O3S
Molecular Weight	214.2814
MDL Number	MFCD22383757
SMILES	COS(=O)(=O)c1c(C)cc(cc1C)C

Methyl 2,4,6-trimethylbenzenesulfonate, commonly known as toluene-2,4,6-trimethylsulfonate, is a versatile compound widely utilized in chemical synthesis for various applications.One of the key uses of Methyl 2,4,6-trimethylbenzenesulfonate is as a protecting group reagent in organic chemistry. It serves as a valuable tool in the protection and deprotection of hydroxyl and amino groups in complex organic molecules during multi-step synthesis processes. By selectively shielding specific functional groups with Methyl 2,4,6-trimethylbenzenesulfonate, chemists can prevent unwanted reactions and control the sequence of chemical reactions to achieve desired products with high purity and yield.Furthermore, Methyl 2,4,6-trimethylbenzenesulfonate is employed as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure and reactivity make it a crucial building block for the construction of complex organic molecules with specific biological activities or functional properties. Additionally, its stability and compatibility with a wide range of reaction conditions make it a highly valuable compound in synthetic organic chemistry.Overall, Methyl 2,4,6-trimethylbenzenesulfonate plays a vital role in modern chemical synthesis by enabling chemists to manipulate and control the chemical reactivity of functional groups, leading to the development of new molecules with diverse applications in industry and research.