
Catalog Number	AR006A82
Chemical Name	Acetic acid,2-(2-formyl-4-nitrophenoxy)-
CAS Number	6965-69-1
Molecular Formula	C9H7NO6
Molecular Weight	225.15498000000002
MDL Number	MFCD00024502
SMILES	O=Cc1cc(ccc1OCC(=O)O)[N+](=O)[O-]
NSC Number	63348

Acetic acid, 2-(2-formyl-4-nitrophenoxy)- is a versatile compound commonly used in chemical synthesis processes. This particular compound finds key applications in organic chemistry due to its unique structural properties and reactivity. In chemical synthesis, acetic acid, 2-(2-formyl-4-nitrophenoxy)- can serve as a crucial building block for the development of various complex organic molecules. Its functional groups make it a valuable intermediate in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. Furthermore, the presence of both the formyl and nitro groups in this compound enables it to participate in a wide range of important chemical reactions, such as nucleophilic addition, reduction, and condensation reactions. These reactions allow for the modification and functionalization of the molecule, leading to the creation of novel compounds with potentially valuable properties. Overall, acetic acid, 2-(2-formyl-4-nitrophenoxy)- plays a significant role in the field of chemical synthesis by providing a platform for the construction of diverse molecular structures with varied applications across industries.

Acetic acid,2-(2-formyl-4-nitrophenoxy)-

6965-69-1

Product Details