
Catalog Number	AR005WXZ
Chemical Name	Benzene,1-(2-methoxyethyl)-4-nitro-
CAS Number	69628-98-4
Molecular Formula	C9H11NO3
Molecular Weight	181.1885
MDL Number	MFCD00634283
SMILES	COCCc1ccc(cc1)[N+](=O)[O-]

1-(2-Methoxyethyl)-4-nitrobenzene, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a crucial building block in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical properties make it an essential intermediate in the synthesis of complex organic molecules.In chemical synthesis, 1-(2-Methoxyethyl)-4-nitrobenzene plays a key role in facilitating key reactions such as nitration, reduction, and substitution. Its nitro group can be selectively modified through reduction to produce a range of valuable derivatives. Furthermore, the methoxyethyl group provides enhanced solubility and compatibility in various reaction conditions, making it a valuable reagent for organic synthesis.Researchers and chemists utilize 1-(2-Methoxyethyl)-4-nitrobenzene to introduce specific functional groups into target molecules, enabling the creation of new compounds with desired properties. Its structural versatility and reactivity make it a valuable tool for designing and synthesizing diverse chemical compounds for various applications in the pharmaceutical, agrochemical, and materials industries.