
Catalog Number	AR005ZUF
Chemical Name	Benzenamine, 4-(4-morpholinylmethyl)-3-(trifluoromethyl)-
CAS Number	694499-30-4
Molecular Formula	C12H15F3N2O
Molecular Weight	260.2555
MDL Number	MFCD25070914
SMILES	Nc1ccc(c(c1)C(F)(F)F)CN1CCOCC1

4-(Morpholinomethyl)-3-(trifluoromethyl)aniline is a versatile compound widely used in chemical synthesis for its unique properties and applications. In organic chemistry, this compound serves as a valuable building block for the synthesis of various biologically active molecules and pharmaceutical intermediates. Its trifluoromethyl group imparts valuable properties such as increased lipophilicity and metabolic stability, making it a valuable component in drug design and development. Furthermore, the morpholinomethyl functionality acts as a versatile protecting group in organic synthesis, enabling selective functionalization of other reactive sites within a molecule. This compound finds applications in medicinal chemistry, agrochemical synthesis, and materials science, highlighting its importance as a key intermediate in modern synthetic chemistry.

Benzenamine, 4-(4-morpholinylmethyl)-3-(trifluoromethyl)-

694499-30-4

Product Details