
Catalog Number	AR0034O3
Chemical Name	4-Chloro-2,5-dimethoxynitrobenzene
CAS Number	6940-53-0
Molecular Formula	C8H8ClNO4
Molecular Weight	217.6064
MDL Number	MFCD00024577
SMILES	COc1cc([N+](=O)[O-])c(cc1Cl)OC
NSC Number	60143

4-Chloro-2,5-dimethoxynitrobenzene is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. One of its prominent applications lies in its role as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and dyes. The presence of the chloro, nitro, and methoxy functional groups in strategic positions on the benzene ring provides ample opportunities for diverse chemical transformations. In organic synthesis, 4-Chloro-2,5-dimethoxynitrobenzene can undergo nucleophilic aromatic substitution reactions to introduce different functional groups, enabling the creation of complex molecular structures. Additionally, its nitro group can be selectively reduced to the amino group, further expanding its synthetic utility. Moreover, the compound's electron-withdrawing and electron-donating groups make it a valuable building block for the construction of heterocyclic compounds and bioactive molecules.Furthermore, 4-Chloro-2,5-dimethoxynitrobenzene's compatibility with various reaction conditions and its predictable reactivity make it a preferred choice for chemists engaged in the synthesis of compounds with diverse applications. Overall, its importance as a versatile intermediate in chemical synthesis cannot be understated, offering a wide array of possibilities for designing and creating novel compounds with targeted properties.