
Catalog Number	AR00610P
Chemical Name	ETHYL-ALPHA-CYANO-4-HYDROXYCINNAMATE
CAS Number	6935-44-0
Molecular Formula	C12H11NO3
Molecular Weight	217.2206
MDL Number	MFCD00188426
SMILES	CCOC(=O)/C(=C/c1ccc(cc1)O)/C#N
NSC Number	52287

(E)-Ethyl 2-cyano-3-(4-hydroxyphenyl)acrylate is a versatile compound that finds wide applications in chemical synthesis. Its unique chemical structure, characterized by the presence of a cyano group and a hydroxyphenyl group, makes it an important building block in the creation of various organic molecules. In chemical synthesis, this compound can serve as a key intermediate for the preparation of pharmaceuticals, agrochemicals, and fine chemicals. By utilizing the cyano group as a functional handle for further derivatization and the hydroxyphenyl group for introducing specific functional groups, chemists can efficiently access a diverse array of molecular structures with tailored properties and activities. Additionally, (E)-Ethyl 2-cyano-3-(4-hydroxyphenyl)acrylate can be incorporated into the synthesis of complex natural products and materials, offering opportunities for the development of novel compounds with potential applications in medicine, materials science, and beyond.