The chemical compound N-(4-Chloro-2-fluorophenyl)-6,7-dimethoxy-4-quinazolinamine, commonly referred to as $name$, serves as a versatile building block in chemical synthesis processes. With its unique molecular structure, $name$ plays a crucial role in the development of various pharmaceuticals, agrochemicals, and materials.$name$ is frequently utilized as a key intermediate in the synthesis of novel drug candidates due to its ability to undergo diverse chemical transformations. Its presence in the molecular design of pharmaceutical compounds imparts desirable pharmacological properties and enhances the overall efficacy of the resultant products. Additionally, $name$ serves as a valuable starting material for the preparation of functional materials and specialty chemicals with tailored properties.In chemical synthesis, the strategic incorporation of $name$ enables chemists to access structurally complex molecules through efficient and selective reactions. By leveraging the distinct reactivity and structural motifs of $name$, researchers can effectively construct intricate molecular architectures with high precision and control. This compound's versatility and synthetic utility make it a valuable asset in the arsenal of synthetic chemists striving to develop innovative compounds for various applications.
sales@aaronchem.com
