
Catalog Number	AR005NUL
Chemical Name	2,6,8-TRIMETHYL-4-QUINOLINAMINE
CAS Number	689277-05-2
Molecular Formula	C12H14N2
Molecular Weight	186.253
MDL Number	MFCD08754056
SMILES	Cc1cc(C)c2c(c1)c(N)cc(n2)C

2,6,8-Trimethylquinolin-4-amine, also known as $name$, is a versatile compound widely used in chemical synthesis processes. This compound serves as a valuable building block in the creation of various organic molecules due to its unique chemical properties. In chemical synthesis, $name$ acts as a key intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Its structure allows for selective modification at different positions to tailor the properties of the final product. Additionally, $name$ plays a crucial role in the development of new materials and research in the field of organic chemistry. Its versatility and reactivity make it a valuable tool for chemists seeking to explore innovative pathways in synthetic chemistry.