
Catalog Number	AR005PF1
Chemical Name	N-(4-bromo-1-methyl-1H-pyrazol-5-yl)-2,2-dimethylpropanamide
CAS Number	679394-11-7
Molecular Formula	C9H14BrN3O
Molecular Weight	260.131
MDL Number	MFCD01763678
SMILES	O=C(C(C)(C)C)Nc1c(Br)cnn1C

N-(4-Bromo-1-methyl-1H-pyrazol-5-yl)pivalamide is a versatile compound widely utilized in chemical synthesis as a key building block for the creation of various pharmaceuticals and agrochemicals. This compound serves as a crucial intermediate in the production of biologically active molecules due to its unique structural features and reactivity. In chemical synthesis, N-(4-Bromo-1-methyl-1H-pyrazol-5-yl)pivalamide plays a vital role in facilitating the formation of complex organic compounds through diverse reactions such as condensation, cyclization, and substitution. Its strategic placement within the molecular structure allows for selective functional group transformations, enabling chemists to access a wide range of molecular architectures efficiently. This compound's compatibility with various synthetic methodologies makes it a valuable tool for the development of novel compounds with potential applications in both medicinal and agricultural fields.

N-(4-bromo-1-methyl-1H-pyrazol-5-yl)-2,2-dimethylpropanamide

679394-11-7

Product Details