
Catalog Number	AR003971
Chemical Name	6-Chloro-2,3,4,5-tetrahydro-7,8-dimethoxy-1-(4-methoxyphenyl)-1H-3-benzazepine
CAS Number	67287-53-0
Molecular Formula	C19H22ClNO3
Molecular Weight	347.8359
MDL Number	MFCD08460175
SMILES	COc1ccc(cc1)C1CNCCc2c1cc(OC)c(c2Cl)OC

6-Chloro-2,3,4,5-tetrahydro-7,8-dimethoxy-1-(4-methoxyphenyl)-1H-3-benzazepine, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound is utilized in the development of various drug molecules and pharmaceutical intermediates owing to its unique structural features and reactivity.One key application of $name$ in chemical synthesis is its use as a precursor in the preparation of novel heterocyclic compounds. Its chloro and methoxy substituents provide sites for further functionalization, enabling the introduction of diverse chemical moieties to modulate the physicochemical properties and biological activities of the target molecules.Moreover, the presence of the benzazepine core in $name$ offers a solid scaffold for the construction of biologically active compounds, particularly in the synthesis of potential drug candidates targeting neurological disorders or related therapeutic areas. The intricate arrangement of atoms in this benzazepine derivative imparts specific stereochemical and electronic properties that are crucial for molecular recognition and interaction with biological targets.By leveraging the synthetic capabilities of 6-Chloro-2,3,4,5-tetrahydro-7,8-dimethoxy-1-(4-methoxyphenyl)-1H-3-benzazepine, chemists can access a wide array of structurally diverse compounds with tailored functionalities, making it a valuable tool in the field of medicinal chemistry and drug discovery.

6-Chloro-2,3,4,5-tetrahydro-7,8-dimethoxy-1-(4-methoxyphenyl)-1H-3-benzazepine

67287-53-0

Product Details