
Catalog Number	AR006LB4
Chemical Name	Piperazine, 1-[3-(triethoxysilyl)propyl]-
CAS Number	67154-23-8
Molecular Formula	C13H30N2O3Si
Molecular Weight	290.4744
SMILES	CCO[Si](OCC)(OCC)CCCN1CCNCC1

The chemical compound 1-[3-(Triethoxysilyl)propyl]piperazine plays a significant role in chemical synthesis as a versatile coupling agent and surface modifier. It is commonly employed in various applications to enhance adhesion and compatibility between organic and inorganic materials. This compound acts as a bridge, facilitating the bonding between different substrates by creating a strong and stable interface. In organic synthesis, it is utilized for functionalizing surfaces, such as modifying siliceous materials, metals, and glass, to improve their properties and reactivity. The presence of the triethoxysilyl group allows for the covalent attachment of the compound to surfaces, leading to enhanced durability and performance of the material. Overall, 1-[3-(Triethoxysilyl)propyl]piperazine is an essential tool in chemical synthesis for promoting effective interactions between diverse components and optimizing material properties.