
Catalog Number	AR003TDG
Chemical Name	2-Acetamido-3-(2-fluorophenyl)propanoic acid
CAS Number	66574-84-3
Molecular Formula	C11H12FNO3
Molecular Weight	225.2163
MDL Number	MFCD00017915
SMILES	CC(=O)NC(C(=O)O)Cc1ccccc1F
NSC Number	270550

2-Acetamido-3-(2-fluorophenyl)propanoic acid, also known by its chemical formula C11H12FNO3, plays a crucial role in chemical synthesis as a versatile building block. This compound is commonly utilized as a key intermediate in the production of pharmaceuticals and agrochemicals due to its functional groups and structural properties. Its unique chemical structure allows for facile modification and manipulation through various reactions, making it a valuable tool for organic chemists. Specifically, 2-Acetamido-3-(2-fluorophenyl)propanoic acid is commonly employed in the synthesis of non-steroidal anti-inflammatory drugs (NSAIDs) and other bioactive compounds. Its involvement in the creation of these important molecules underscores its significance in the field of medicinal chemistry and pharmaceutical development. Additionally, its strategic placement of functional groups enables the facilitation of further derivatization, leading to the generation of diverse compounds with enhanced biological activities. In summary, the application of 2-Acetamido-3-(2-fluorophenyl)propanoic acid in chemical synthesis showcases its importance as a valuable precursor in the creation of bioactive molecules with therapeutic potential.