
Catalog Number	AR003616
Chemical Name	Naphthalene-1,3,5-trisulfonic acid
CAS Number	6654-64-4
Molecular Formula	C10H8O9S3
Molecular Weight	368.3601
MDL Number	MFCD03265508
SMILES	OS(=O)(=O)c1cc2c(c(c1)S(=O)(=O)O)cccc2S(=O)(=O)O

Naphthalene-1,3,5-trisulfonic acid is a versatile compound commonly employed in chemical synthesis due to its unique properties and reactivity. As a sulfonic acid derivative of naphthalene, this compound offers a convenient platform for introducing sulfonate groups into various organic molecules. Its tri-sulfonic acid functionality enables it to act as a strong acid catalyst in numerous organic reactions, promoting condensation, alkylation, and esterification processes. Furthermore, naphthalene-1,3,5-trisulfonic acid's hygroscopic nature makes it a valuable component in the production of hygroscopic salts and coordination complexes, enhancing their solubility and stability in aqueous solutions. Moreover, its presence in chemical synthesis can facilitate the synthesis of dyes, pigments, and pharmaceutical compounds by serving as a key intermediate for modifying organic structures and enhancing solubility and bioavailability.