
Catalog Number	AR006NMB
Chemical Name	TGX-221
CAS Number	663619-89-4
Molecular Formula	C21H24N4O2
Molecular Weight	364.4409
MDL Number	MFCD27979002
SMILES	Cc1cc(C(Nc2ccccc2)C)c2n(c1)c(=O)cc(n2)N1CCOCC1

The small molecule compound TGX-221 is widely utilized in chemical synthesis as a potent and selective inhibitor of the enzyme PI3K. This inhibitor plays a critical role in various cellular processes, making TGX-221 a valuable tool for researchers and chemists alike. In chemical synthesis, TGX-221 is utilized in the development of novel drugs, as it can modulate specific signaling pathways involved in disease progression. By targeting PI3K, TGX-221 has shown promising results in inhibiting cancer cell growth and proliferation, making it a potential candidate for anticancer drug development. Additionally, TGX-221 has been explored for its role in inflammation and autoimmune diseases, highlighting its versatility in various therapeutic applications. In research settings, TGX-221 is used to elucidate the intricate mechanisms of PI3K signaling pathways, providing valuable insights for drug discovery and development. With its potent inhibitory effects and versatile applications, TGX-221 holds great potential in advancing the field of chemical synthesis and drug development.