
Catalog Number	AR003GPO
Chemical Name	2,5-dioxopyrrolidin-1-yl 4-((5-nitropyridin-2-yl)disulfanyl)pentanoate
CAS Number	663598-61-6
Molecular Formula	C14H15N3O6S2
Molecular Weight	385.4154
MDL Number	MFCD20230055
SMILES	O=C(ON1C(=O)CCC1=O)CCC(SSc1ccc(cn1)[N+](=O)[O-])C

2,5-dioxopyrrolidin-1-yl 4-((5-nitropyridin-2-yl)disulfanyl)pentanoate is a versatile compound widely used in chemical synthesis as a key building block in organic reactions. Its unique structure allows for the introduction of both pyrrolidinone and nitropyridine functionalities, making it a valuable tool in the creation of complex molecules.One of the primary applications of this compound is in the synthesis of pharmaceutical intermediates and heterocyclic compounds. Its ability to undergo various chemical transformations, such as nucleophilic substitution and oxidation-reduction reactions, enables the efficient assembly of diverse molecular structures with desired pharmacological properties.Furthermore, 2,5-dioxopyrrolidin-1-yl 4-((5-nitropyridin-2-yl)disulfanyl)pentanoate plays a crucial role in the development of novel materials and organic electronic devices. By incorporating this compound into the polymer backbone or as a functional group on surfaces, researchers can tailor the physical and electronic properties of the resulting materials for applications in optoelectronics, sensors, and nanotechnology.Overall, the unique reactivity and functionality of 2,5-dioxopyrrolidin-1-yl 4-((5-nitropyridin-2-yl)disulfanyl)pentanoate make it a valuable asset in chemical synthesis, offering limitless possibilities for the creation of new compounds and materials with tailored properties and applications in various fields.