
Catalog Number	AR003A11
Chemical Name	Chicoric acid
CAS Number	6537-80-0
Molecular Formula	C22H18O12
Molecular Weight	474.3711
MDL Number	MFCD00189418
SMILES	O=C(O[C@H]([C@H](C(=O)O)OC(=O)/C=C/c1ccc(c(c1)O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O
NSC Number	699173

Chicoric acid, also known as dicaffeoyl-tartaric acid, is a natural compound found in various plant sources, such as chicory and Echinacea. In chemical synthesis, chicoric acid is commonly used as a building block for the production of more complex molecules due to its unique structural properties.One of the key applications of chicoric acid in chemical synthesis is its role as a precursor in the synthesis of novel pharmaceutical compounds. By leveraging the functional groups present in chicoric acid, chemists can modify its structure through various chemical reactions to create new drug candidates with improved biological activities or pharmacokinetic properties.Additionally, chicoric acid serves as a valuable starting material in the synthesis of bioactive compounds used in the food and cosmetic industries. Its antioxidant properties make it a desirable ingredient in skincare formulations, while its bitter taste enhances the flavor profile of certain food products.Overall, chicoric acid plays a crucial role in advancing the field of chemical synthesis by serving as a versatile building block for the creation of diverse compounds with potential applications in pharmaceuticals, cosmetics, and food products.

Chicoric acid

6537-80-0

Product Details