
Catalog Number	AR003RIE
Chemical Name	gossypin
CAS Number	652-78-8
Molecular Formula	C21H20O13
Molecular Weight	480.3757
MDL Number	MFCD00017429
SMILES	OC[C@H]1O[C@@H](Oc2c(O)cc(c3c2oc(c2ccc(c(c2)O)O)c(c3=O)O)O)[C@@H]([C@H]([C@@H]1O)O)O

Gossypin, a natural flavonoid compound found in hibiscus and cotton plant extracts, has gained substantial attention for its versatile applications in chemical synthesis. In particular, Gossypin has demonstrated promising potential as a key ingredient in the development of novel pharmaceuticals, agrochemicals, and functional materials. In chemical synthesis, Gossypin serves as a valuable building block due to its unique molecular structure and reactivity. Its multiple functional groups, including hydroxyl and carbonyl groups, enable diverse chemical transformations such as acylation, alkylation, and oxidation. These reactions allow for the modification and functionalization of Gossypin to create structurally diverse compounds with enhanced properties.Moreover, Gossypin's bioactive properties make it an attractive candidate for the synthesis of bioactive molecules and drug candidates. Studies have shown that Gossypin exhibits antioxidant, anti-inflammatory, and anticancer activities, which can be leveraged in the design of new pharmaceutical agents. By incorporating Gossypin into medicinal chemistry frameworks, researchers can explore its therapeutic potential in treating various diseases and disorders.Additionally, Gossypin's role in chemical synthesis extends to the development of environmentally sustainable agrichemicals. Its natural origin and biodegradability make it an eco-friendly alternative for formulating pesticide and fungicide products. By harnessing Gossypin's chemical reactivity and bioactivity, scientists can create innovative agrochemical solutions that minimize environmental impact and promote sustainable agricultural practices.Overall, Gossypin's versatility in chemical synthesis opens up a wide range of opportunities for creating advanced materials, pharmaceuticals, and agrochemicals with enhanced properties and functionalities. Its unique combination of structural features and biological activities make it a valuable asset in the realm of modern chemistry and innovation.