
Catalog Number	AR00EHF3
Chemical Name	24Dichloro-5methoxyacetanilide
CAS Number	65182-98-1
Molecular Formula	C9H9Cl2NO2
Molecular Weight	234.0793
MDL Number	MFCD17014778
SMILES	COc1cc(NC(=O)C)c(cc1Cl)Cl

N-(2,4-Dichloro-5-methoxyphenyl)acetamide, also known as $name$, exhibits versatile applications in chemical synthesis. This compound serves as a building block in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure makes it a valuable intermediate in the synthesis of complex organic molecules, allowing for the creation of novel compounds with diverse properties and applications. With its strategic placement of functional groups, N-(2,4-Dichloro-5-methoxyphenyl)acetamide facilitates efficient and selective reactions, making it a valuable tool for organic chemists in designing and constructing molecular structures with specific functionalities. In the realm of chemical synthesis, this compound plays a crucial role in extending the frontiers of synthetic chemistry and enabling the development of new chemical entities with potential applications in various fields.