
Catalog Number	AR003K4G
Chemical Name	3-Fluoro-4-(methylsulfonyl)phenylboronic acid
CAS Number	648904-83-0
Molecular Formula	C7H8BFO4S
Molecular Weight	218.01042320000002
MDL Number	MFCD09878323
SMILES	OB(c1ccc(c(c1)F)S(=O)(=O)C)O

3-Fluoro-4-(methylsulfonyl)phenylboronic acid is a versatile and valuable reagent used in organic chemistry for diverse chemical synthesis applications. This compound acts as a key building block in the formation of carbon-carbon and carbon-heteroatom bonds through Suzuki-Miyaura cross-coupling reactions. By serving as an effective boronic acid derivative, it enables the introduction of the 3-fluoro-4-(methylsulfonyl)phenyl group into complex molecular frameworks with high efficiency and selectivity. This compound plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and materials science, making it a valuable tool for synthetic chemists seeking to access diverse molecular structures with specific fluorine-containing functionalities.

3-Fluoro-4-(methylsulfonyl)phenylboronic acid

648904-83-0

Product Details