
Catalog Number	AR003CDQ
Chemical Name	(S)-1-((S)-3-(Acetylthio)-2-methylpropanoyl)pyrrolidine-2-carboxylic acid
CAS Number	64838-55-7
Molecular Formula	C11H17NO4S
Molecular Weight	259.322
MDL Number	MFCD07809564
SMILES	CC(=O)SC[C@H](C(=O)N1CCC[C@H]1C(=O)O)C

The compound 1-[(2S)-3-(Acetylthio)-2-methyl-1-oxopropyl]-L-proline plays a crucial role in chemical synthesis as a key intermediate in peptide and amino acid synthesis. This compound is commonly used for the creation of peptide bonds and building complex organic structures due to its unique properties. Its acetylthio group allows for selective and controlled reactions, while its proline backbone contributes to the stabilization of peptide structures. Overall, this compound serves as a versatile tool in the development of new pharmaceuticals, agrochemicals, and materials with specific functions.

(S)-1-((S)-3-(Acetylthio)-2-methylpropanoyl)pyrrolidine-2-carboxylic acid

64838-55-7

Product Details