
Catalog Number	AR00EC38
Chemical Name	4-FLUORO-L-PHENYLALANINE HYDROCHLORIDE
CAS Number	64231-54-5
Molecular Formula	C9H11ClFNO2
Molecular Weight	219.6405
MDL Number	MFCD01863499
SMILES	N[C@H](C(=O)O)Cc1ccc(cc1)F.Cl

(S)-2-Amino-3-(4-fluorophenyl)propanoic acid hydrochloride, also known as $name$, serves as a versatile intermediate in chemical synthesis processes. This compound plays a crucial role in organic chemistry due to its ability to act as a chiral building block. By incorporating this compound in synthesis routes, chemists can access a diverse range of structurally complex molecules with specific stereochemical configurations. The presence of the fluorine substituent enhances the reactivity and selectivity of reactions, making it a valuable tool in the creation of pharmaceuticals, agrochemicals, and materials with tailored properties. Moreover, the hydrochloride salt form of (S)-2-Amino-3-(4-fluorophenyl)propanoic acid provides improved solubility and stability in aqueous environments, further expanding its utility in various synthetic methodologies.