
Catalog Number	AR003OAZ
Chemical Name	(1R,4aR,4bR,10aR)-Ethyl 7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,4b,5,6,10,10a-decahydrophenanthrene-1-carboxylate
CAS Number	631-71-0
Molecular Formula	C22H34O2
Molecular Weight	330.5042
MDL Number	MFCD00028860
SMILES	CCOC(=O)[C@]1(C)CCC[C@]2([C@H]1CC=C1[C@@H]2CCC(=C1)C(C)C)C

The compound (1R,4aR,4bR,10aR)-Ethyl 7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,4b,5,6,10,10a-decahydrophenanthrene-1-carboxylate can be used in chemical synthesis as a building block for creating complex organic molecules. Its unique structure and functional groups allow for strategic manipulation and derivatization to introduce specific chemical moieties or stereochemistry into a target compound. By incorporating this compound into a synthesis pathway, chemists can access a diverse range of structurally elaborate compounds with potential applications in pharmaceuticals, materials science, and other fields of chemical research.

(1R,4aR,4bR,10aR)-Ethyl 7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,4b,5,6,10,10a-decahydrophenanthrene-1-carboxylate

631-71-0

Product Details