
Catalog Number	AR003RIG
Chemical Name	G-STROPHANTHIN
CAS Number	630-60-4
Molecular Formula	C29H44O12
Molecular Weight	584.6525
MDL Number	MFCD00149240
SMILES	OC[C@@]12[C@H](O)C[C@H](C[C@@]2(O)CC[C@@H]2[C@@H]1[C@H](O)C[C@]1([C@]2(O)CC[C@@H]1C1=CC(=O)OC1)C)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O

The organic chemical compound ouabain is widely recognized for its potential applications in chemical synthesis. Ouabain, also known as g-strophantin or g-strophanthin, is a natural product derived from the seeds of the African plant Acocanthera schimperi.In chemical synthesis, ouabain can serve as a valuable building block for the creation of novel compounds due to its unique structural characteristics. Its steroidal framework and presence of functional groups make it a versatile starting material for the development of various pharmaceuticals and organic molecules. Ouabain's complex molecular structure lends itself well to modifications and derivatizations that can lead to the synthesis of new drugs, agrochemicals, and materials.Furthermore, ouabain's biological properties, such as its ability to inhibit the Na+/K+-ATPase enzyme, open up avenues for designing new bioactive molecules with potential therapeutic effects. By leveraging ouabain's interactions with biological targets, chemists can explore its role in drug discovery and development.Overall, ouabain's multifaceted attributes make it a promising candidate for applications in chemical synthesis, offering researchers an intriguing platform for innovation and exploration in the field of organic chemistry.

Card-20(22)-enolide, 3-[(2,6-dideoxy-4-O-β-D-glucopyranosyl-3-O-methyl-β-D-ribo-hexopyranosyl)oxy]-5,14-dihydroxy-, (3β,5β)-

13137-64-9

Product Details

Card-20(22)-enolide, 3-[(O-β-D-glucopyranosyl-(1→4)-O-3-O-acetyl-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-O-2,6-dideoxy-β-D-ribo-hexopyranosyl-(1→4)-2,6-dideoxy-β-D-ribo-hexopyranosyl)oxy]-12,14-dihydroxy-, (3β,5β,12β)-

17575-22-3

Product Details