
Catalog Number	AR00EENC
Chemical Name	3-Amino-1-adamantanecarboxylic acid
CAS Number	6240-10-4
Molecular Formula	C11H17NO2
Molecular Weight	195.2582
MDL Number	MFCD01837822
SMILES	OC(=O)[C@]12C[C@@H]3C[C@H](C1)C[C@](C2)(C3)N

Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-amino, is a versatile compound widely utilized in chemical synthesis as a key building block for creating intricate molecular structures. With its unique tricyclic framework and amino group functionality, this compound serves as a valuable intermediate in the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Chemists leverage its distinctive structure and reactivity to introduce specific functionalities and tailor the properties of target molecules, enabling the formation of complex chemical scaffolds with precise stereochemical control. This compound plays a crucial role in the development of innovative organic compounds with diverse applications across industries.