
Catalog Number	AR003ITS
Chemical Name	3-(4-Methoxyphenoxy)benzaldehyde
CAS Number	62373-80-2
Molecular Formula	C14H12O3
Molecular Weight	228.2433
MDL Number	MFCD00003358
SMILES	COc1ccc(cc1)Oc1cccc(c1)C=O

3-(4-Methoxyphenoxy)benzaldehyde is a versatile compound commonly employed in chemical synthesis for its unique properties and reactivity. This aldehyde derivative plays a crucial role in the creation of various aromatic compounds, pharmaceuticals, and agrochemicals. In organic synthesis, 3-(4-Methoxyphenoxy)benzaldehyde serves as a key building block for the formation of more complex molecules with specific functional groups. Its aldehyde group allows for facile reactions with nucleophiles, such as Grignard reagents and organolithium compounds, enabling the introduction of diverse substituents at the para-position of the phenyl ring. Additionally, the methoxy group on the phenyl ring imparts electronic effects that can influence the compound's reactivity and stability in different chemical environments. This feature makes 3-(4-Methoxyphenoxy)benzaldehyde a valuable intermediate in the synthesis of bioactive compounds, dyes, and fragrances.Furthermore, the benzaldehyde moiety in 3-(4-Methoxyphenoxy)benzaldehyde offers a platform for the construction of more complex structures through traditional organic transformations like acylation, reduction, and condensation reactions. By utilizing this versatile compound in chemical synthesis, researchers can access a wide array of molecular architectures with tailored properties for various applications in the fields of material science, medicinal chemistry, and more.