
Catalog Number	AR00EHC1
Chemical Name	epsilon-Viniferin
CAS Number	62218-08-0
Molecular Formula	C28H22O6
Molecular Weight	454.4707
MDL Number	MFCD12964987
SMILES	Oc1ccc(cc1)/C=C/c1cc(O)cc2c1[C@@H](c1cc(O)cc(c1)O)[C@@H](O2)c1ccc(cc1)O

Epsilon-viniferin is a natural stilbene compound that has garnered significant attention in the field of chemical synthesis due to its versatile applications. In organic chemistry, epsilon-viniferin serves as a valuable starting material for the synthesis of various bioactive molecules and pharmaceutical compounds. Its unique chemical structure, containing multiple phenolic groups and a stilbene backbone, makes it an attractive candidate for the development of new drugs, agrochemicals, and functional materials.One of the key applications of epsilon-viniferin in chemical synthesis is its role as a precursor for the synthesis of resveratrol analogs. Resveratrol, a well-known polyphenolic compound found in red wine and various plants, has been studied for its potential health benefits, including anti-inflammatory and antioxidant properties. By modifying the structure of epsilon-viniferin through chemical reactions such as hydroxylation, methylation, or esterification, researchers can generate analogs with enhanced biological activities or improved pharmacokinetic properties.Furthermore, epsilon-viniferin can be used as a building block for the synthesis of natural product derivatives or complex molecules with therapeutic potential. Through strategic synthetic manipulations, chemists can access a diverse array of compounds inspired by epsilon-viniferin's core structure, enabling the exploration of new chemical space and the discovery of novel drugs or bioactive agents. Its synthetic accessibility and reactivity make epsilon-viniferin a valuable tool for the design and development of molecular scaffolds with biological relevance.Overall, the utilization of epsilon-viniferin in chemical synthesis offers a promising avenue for the creation of innovative compounds with pharmaceutical, agricultural, or material science applications. By harnessing the chemical reactivity and structural features of epsilon-viniferin, researchers can explore new avenues in drug discovery, functional materials design, and chemical biology, thereby contributing to the advancement of science and technology.