
Catalog Number	AR003RVQ
Chemical Name	L-(+)-Mandelic acid benzyl ester
CAS Number	62173-99-3
Molecular Formula	C15H14O3
Molecular Weight	242.2699
MDL Number	MFCD00274325
SMILES	O[C@@H](c1ccccc1)C(=O)OCc1ccccc1

(S)-Benzyl 2-hydroxy-2-phenylacetate, also known as (S)-mandelic acid benzyl ester, serves as a valuable intermediate in chemical synthesis processes. This compound plays a crucial role in various organic reactions and transformations due to its unique structural properties. In chemical synthesis, (S)-Benzyl 2-hydroxy-2-phenylacetate is commonly utilized as a chiral building block for the asymmetric synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Its chiral nature allows for precise control over the stereochemistry of the final products, making it a versatile tool for the development of complex molecules with specific biological or chemical activities. Additionally, (S)-Benzyl 2-hydroxy-2-phenylacetate can undergo various chemical transformations such as esterification, hydrogenation, and hydrolysis, enabling the synthesis of diverse molecular structures with tailored properties. Overall, the application of (S)-Benzyl 2-hydroxy-2-phenylacetate in chemical synthesis provides chemists with a powerful tool for designing and creating novel compounds with desired stereochemical and functional characteristics.