
Catalog Number	AR00I9U2
Chemical Name	Benzeneacetic acid, a-(acetyloxy)-, (aR)-
CAS Number	51019-43-3
Molecular Formula	C10H10O4
Molecular Weight	194.1840
MDL Number	MFCD00004249
SMILES	OC(=O)[C@@H](c1ccccc1)OC(=O)C

The (R)-2-Acetoxy-2-phenylacetic acid is a valuable chiral building block commonly used in chemical synthesis. It serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its chirality, imparted by the (R) configuration, plays a crucial role in determining the stereochemistry of the final compounds.In chemical synthesis, (R)-2-Acetoxy-2-phenylacetic acid is often utilized as a versatile precursor for the asymmetric construction of complex molecules. Its unique structure allows for the introduction of functional groups at specific positions, enabling the creation of diverse compounds with controlled stereochemistry and reactivity.The compound exhibits excellent compatibility with a wide range of reaction conditions, making it a valuable tool for organic chemists seeking to access enantiopure compounds with high levels of selectivity. By incorporating (R)-2-Acetoxy-2-phenylacetic acid into synthetic pathways, chemists can streamline the production of target molecules with enhanced efficiency and purity.Overall, the application of (R)-2-Acetoxy-2-phenylacetic acid in chemical synthesis underscores its significance as a building block for designing and synthesizing complex organic molecules with desired stereochemical properties.