
Catalog Number	AR00383G
Chemical Name	3,4-Dinitroaniline
CAS Number	610-41-3
Molecular Formula	C6H5N3O4
Molecular Weight	183.1216
MDL Number	MFCD00456811
SMILES	Nc1ccc(c(c1)[N+](=O)[O-])[N+](=O)[O-]

3,4-Dinitroaniline is a versatile chemical compound that finds numerous applications in chemical synthesis. One of its key uses is as a precursor in the synthesis of various dyes and pigments. Due to its unique chemical properties, 3,4-Dinitroaniline serves as a valuable building block in the creation of vibrant and long-lasting colorants used in industries such as textiles, plastics, and coatings.Furthermore, 3,4-Dinitroaniline is often employed as a reagent in organic chemistry reactions, particularly in the development of pharmaceutical compounds. Its ability to undergo various transformations makes it a valuable tool for chemists seeking to introduce specific functionalities or structural motifs into target molecules. This compound's presence in the realm of chemical synthesis highlights its significance as a key player in the creation of novel materials and substances with diverse applications.

3,4-Dinitroaniline

610-41-3

Product Details