
Catalog Number	AR003QBI
Chemical Name	Dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate
CAS Number	5825-71-8
Molecular Formula	C11H10N2O4
Molecular Weight	234.2081
MDL Number	MFCD06411548
SMILES	COC(=O)c1nn2c(c1C(=O)OC)cccc2

Dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the creation of novel organic molecules, particularly in the development of pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, Dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate acts as a key intermediate in the synthesis of complex heterocyclic structures. Its structural features make it an important precursor for the construction of fused ring systems, allowing for the preparation of diverse molecular architectures with specific functionalities.The compound's ability to undergo various chemical transformations, such as cross-coupling reactions, cycloadditions, and cyclization reactions, makes it a valuable tool for synthetic chemists in designing and accessing new compounds with potential biological activities or material properties.Overall, Dimethyl pyrazolo[1,5-a]pyridine-2,3-dicarboxylate plays a crucial role in advancing the field of chemical synthesis by enabling the efficient and strategic construction of complex molecules for applications in drug discovery, agrochemical development, and material science research.