
Catalog Number	AR003DG5
Chemical Name	2-NITRO-5-(PROPYLTHIO)ANILINE
CAS Number	57780-75-3
Molecular Formula	C9H12N2O2S
Molecular Weight	212.2688
MDL Number	MFCD00192355
SMILES	CCCSc1ccc(c(c1)N)[N+](=O)[O-]

2-Nitro-5-(propylthio)aniline is a versatile compound that finds significant application in chemical synthesis, particularly in the field of organic chemistry. Known for its unique properties, this compound is commonly used as a key building block in the production of various pharmaceuticals, dyes, and agrochemicals.In chemical synthesis, 2-Nitro-5-(propylthio)aniline serves as a valuable intermediate in the creation of complex organic molecules. Its nitro and thio functional groups allow for a wide range of reactions, making it a versatile starting material for the synthesis of diverse chemical compounds.One of the prominent applications of 2-Nitro-5-(propylthio)aniline is in the synthesis of bioactive molecules. By manipulating its chemical structure through various reactions, researchers can create new compounds with potential medicinal properties. This compound's involvement in drug development highlights its importance in the pharmaceutical industry.Additionally, 2-Nitro-5-(propylthio)aniline plays a crucial role in the synthesis of dyes and pigments. Its ability to undergo color-forming reactions makes it an essential component in the production of vibrant and stable colorants used in various industries.Furthermore, this compound is utilized in the synthesis of agrochemicals, where its molecular structure can be modified to enhance the efficiency of pesticides and herbicides. By incorporating 2-Nitro-5-(propylthio)aniline into the chemical synthesis of agricultural products, researchers can develop potent compounds for crop protection and pest control.Overall, the diverse applications of 2-Nitro-5-(propylthio)aniline in chemical synthesis underscore its significance as a crucial building block in the creation of various functional molecules in industries such as pharmaceuticals, dyes, and agrochemicals.

2-NITRO-5-(PROPYLTHIO)ANILINE

57780-75-3

Product Details