
Catalog Number	AR003J39
Chemical Name	Phenol, 2,3,4,5-tetrabromo-6-methyl-
CAS Number	576-55-6
Molecular Formula	C7H4Br4O
Molecular Weight	423.72205999999994
MDL Number	MFCD00002148
SMILES	Oc1c(C)c(Br)c(c(c1Br)Br)Br
NSC Number	4866

Phenol, 2,3,4,5-tetrabromo-6-methyl- is a unique compound with valuable applications in chemical synthesis. This compound serves as a key building block in the production of various organic compounds and materials. Due to its specific structure, Phenol, 2,3,4,5-tetrabromo-6-methyl- plays a crucial role as a versatile intermediate in the synthesis of agrochemicals, pharmaceuticals, and specialty chemicals. Its distinct properties make it a valuable tool for creating complex structures and functional groups, enabling chemists to develop innovative and efficient synthetic routes. In the realm of organic synthesis, Phenol, 2,3,4,5-tetrabromo-6-methyl- offers a wide range of possibilities for designing and constructing diverse molecular architectures.