
Catalog Number	AR003TWU
Chemical Name	H-His(1-Me)-OMe
CAS Number	57519-09-2
Molecular Formula	C8H13N3O2
Molecular Weight	183.2077
MDL Number	MFCD17976858
SMILES	COC(=O)[C@H](Cc1ncn(c1)C)N

H-His(1-Me)-OMe, a derivative of histidine with a methyl group attached to the first position, is a versatile compound widely utilized in chemical synthesis. Its unique structure and properties make it a valuable building block for the creation of complex molecules and the modification of peptides.One of the key applications of H-His(1-Me)-OMe in chemical synthesis is its role as a protected form of histidine. By incorporating this derivative into peptide synthesis, chemists can selectively add the histidine component at specific points in the peptide chain without interference from other reactive groups. This allows for precise control over the sequence and structure of the final peptide product.Additionally, H-His(1-Me)-OMe can be used to introduce stereochemical diversity into peptide molecules. The presence of the methyl group at the first position of histidine alters the overall conformation of the peptide, leading to potential changes in biological activity or binding affinity. This feature makes H-His(1-Me)-OMe a valuable tool for designing and studying peptide-based drugs, inhibitors, and ligands in medicinal chemistry research.Overall, the application of H-His(1-Me)-OMe in chemical synthesis offers a strategic approach to tailor peptide structures, manipulate molecular interactions, and explore new avenues in drug discovery and biological research.