
Catalog Number	AR003GCD
Chemical Name	2,4,6-TRIISOPROPYLBENZOYL CHLORIDE
CAS Number	57199-00-5
Molecular Formula	C16H23ClO
Molecular Weight	266.8062
MDL Number	MFCD00015030
SMILES	CC(c1cc(cc(c1C(=O)Cl)C(C)C)C(C)C)C

2,4,6-Triisopropylbenzoylchloride, also known as TIBCl, is a valuable chemical reagent utilized in various chemical synthesis processes. This compound plays a crucial role in organic synthesis as a key intermediate in the production of pharmaceuticals, agrochemicals, and specialty chemicals. TIBCl is commonly employed as a reactive acylating agent in the modification of functional groups on organic molecules, allowing for the introduction of new chemical functionalities. Through its unique reactivity, 2,4,6-Triisopropylbenzoylchloride enables the selective and controlled formation of esters, amides, and other key chemical bonds, making it an essential component in the design and preparation of complex organic compounds. Its versatile nature and high reactivity make it a valuable tool for chemists seeking to tailor the structure and properties of molecules for specific applications in the fields of medicine, agriculture, and materials science.