
Catalog Number	AR003LXV
Chemical Name	_x005F_x000D_4-Cyano-4-(4-fluorophenyl)cyclohexanone
CAS Number	56326-98-8
Molecular Formula	C13H12FNO
Molecular Weight	217.2389
MDL Number	MFCD00044815
SMILES	N#CC1(CCC(=O)CC1)c1ccc(cc1)F

4-Cyano-4-(4-fluorophenyl)cyclohexanone is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable building block in the preparation of various organic molecules due to its cyano and fluorophenyl functional groups, which are crucial for the formation of complex structures. In particular, 4-Cyano-4-(4-fluorophenyl)cyclohexanone is employed in the synthesis of pharmaceutical compounds, agrochemicals, and materials science applications. Its ability to participate in key reactions such as nucleophilic additions, cycloadditions, and condensation reactions makes it an essential intermediate in the production of fine chemicals and biologically active molecules. Additionally, the presence of the cyano group allows for further derivatization, enabling the modification and customization of the molecular structure for specific purposes. Overall, the strategic incorporation of 4-Cyano-4-(4-fluorophenyl)cyclohexanone in chemical synthesis facilitates the efficient and precise construction of diverse organic compounds with tailored properties and functions.